ChemNet > CAS > 332927-03-4 Acridine-9-carboxylic acid hydrate
332927-03-4 Acridine-9-carboxylic acid hydrate
상품명칭 |
Acridine-9-carboxylic acid hydrate |
별명 |
acridine-9-carboxylic acid; acridine-9-carboxylate |
분자식 |
C14H9NO2 |
분자량 |
222.2194 |
InChI |
InChI=1/C14H9NO2/c16-14(17)13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,(H,16,17)/p-1 |
cas번호 |
332927-03-4 |
분자 구조 |
|
녹는 점 |
290℃ |
비등점 |
480.4°C at 760 mmHg |
인화점 |
244.3°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|